C14H16ClF3N2O3 — CID 167964651
tert-butyl N-[4-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 167964651) has the molecular formula C14H16ClF3N2O3 and a molecular weight of 352.74 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 167964651 |
| Molecular Formula | C14H16ClF3N2O3 |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | tert-butyl N-[4-[(2-chloroacetyl)amino]-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC(=O)CCl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16ClF3N2O3/c1-13(2,3)23-12(22)19-8-4-5-10(20-11(21)7-15)9(6-8)14(16,17)18/h4-6H,7H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | DFIVBEBSKXRWQR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|