C13H13ClF3NO3 — CID 134284184
tert-butyl N-[4-carbonochloridoyl-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 134284184) has the molecular formula C13H13ClF3NO3 and a molecular weight of 323.70 g/mol. Its IUPAC name is tert-butyl N-[4-carbonochloridoyl-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-carbonochloridoyl-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 134284184 |
| Molecular Formula | C13H13ClF3NO3 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | tert-butyl N-[4-carbonochloridoyl-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13ClF3NO3/c1-12(2,3)21-11(20)18-7-4-5-8(10(14)19)9(6-7)13(15,16)17/h4-6H,1-3H3,(H,18,20) |
| InChIKey | RLROFKJIWIFHBA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|