C19H20F3N3O3 — CID 91398764
tert-butyl N-[4-[(2-aminobenzoyl)amino]-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 91398764) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-aminobenzoyl)amino]-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-aminobenzoyl)amino]-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 91398764 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl N-[4-[(2-aminobenzoyl)amino]-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC(=O)c2ccccc2N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-18(2,3)28-17(27)24-11-8-9-15(13(10-11)19(20,21)22)25-16(26)12-6-4-5-7-14(12)23/h4-10H,23H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | VIVANSKIJJVYEH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|