C22H32N4O4 — CID 159167301
tert-butyl N-(2-aminophenyl)carbamate;tert-butyl N-(4-aminophenyl)carbamate (PubChem CID 159167301) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is tert-butyl N-(2-aminophenyl)carbamate;tert-butyl N-(4-aminophenyl)carbamate.
| Compound Name | tert-butyl N-(2-aminophenyl)carbamate;tert-butyl N-(4-aminophenyl)carbamate |
|---|---|
| PubChem CID | 159167301 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | tert-butyl N-(2-aminophenyl)carbamate;tert-butyl N-(4-aminophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N)cc1.CC(C)(C)OC(=O)Nc1ccccc1N |
| InChI | InChI=1S/2C11H16N2O2/c1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9;1-11(2,3)15-10(14)13-9-7-5-4-6-8(9)12/h2*4-7H,12H2,1-3H3,(H,13,14) |
| InChIKey | KLFSJPQRGCQMHO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|