C20H29N5O3 — CID 162109745
benzene-1,2-diamine;tert-butyl N-[3-(2-aminoanilino)-3-oxopropyl]carbamate (PubChem CID 162109745) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is benzene-1,2-diamine;tert-butyl N-[3-(2-aminoanilino)-3-oxopropyl]carbamate.
| Compound Name | benzene-1,2-diamine;tert-butyl N-[3-(2-aminoanilino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 162109745 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | benzene-1,2-diamine;tert-butyl N-[3-(2-aminoanilino)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1ccccc1N.Nc1ccccc1N |
| InChI | InChI=1S/C14H21N3O3.C6H8N2/c1-14(2,3)20-13(19)16-9-8-12(18)17-11-7-5-4-6-10(11)15;7-5-3-1-2-4-6(5)8/h4-7H,8-9,15H2,1-3H3,(H,16,19)(H,17,18);1-4H,7-8H2 |
| InChIKey | ZFZJBBILPFQETD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|