C12H19N5O3 — CID 70812164
tert-butyl N-[3-[(4-aminopyrimidin-5-yl)amino]-3-oxopropyl]carbamate (PubChem CID 70812164) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-aminopyrimidin-5-yl)amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-aminopyrimidin-5-yl)amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 70812164 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | tert-butyl N-[3-[(4-aminopyrimidin-5-yl)amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1cncnc1N |
| InChI | InChI=1S/C12H19N5O3/c1-12(2,3)20-11(19)15-5-4-9(18)17-8-6-14-7-16-10(8)13/h6-7H,4-5H2,1-3H3,(H,15,19)(H,17,18)(H2,13,14,16) |
| InChIKey | GKUWDIKEXNTAFQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |