C12H18N4O3 — CID 122135229
tert-butyl N-[3-oxo-3-(pyrazin-2-ylamino)propyl]carbamate (PubChem CID 122135229) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-(pyrazin-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-(pyrazin-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 122135229 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | tert-butyl N-[3-oxo-3-(pyrazin-2-ylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1cnccn1 |
| InChI | InChI=1S/C12H18N4O3/c1-12(2,3)19-11(18)15-5-4-10(17)16-9-8-13-6-7-14-9/h6-8H,4-5H2,1-3H3,(H,15,18)(H,14,16,17) |
| InChIKey | UTGCWZUSAMIVOA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |