C17H27N5O3 — CID 154762882
tert-butyl N-[2-cyclopropyl-2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]propyl]carbamate (PubChem CID 154762882) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is tert-butyl N-[2-cyclopropyl-2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclopropyl-2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 154762882 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl N-[2-cyclopropyl-2-[[2-oxo-2-(pyrazin-2-ylamino)ethyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(NCC(=O)Nc1cnccn1)C1CC1 |
| InChI | InChI=1S/C17H27N5O3/c1-16(2,3)25-15(24)20-11-17(4,12-5-6-12)21-10-14(23)22-13-9-18-7-8-19-13/h7-9,12,21H,5-6,10-11H2,1-4H3,(H,20,24)(H,19,22,23) |
| InChIKey | FDJYVOYOJOGSCG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |