C15H26N4O2 — CID 103740239
tert-butyl N-[2-cyclopropyl-2-(1H-imidazol-5-ylmethylamino)propyl]carbamate (PubChem CID 103740239) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is tert-butyl N-[2-cyclopropyl-2-(1H-imidazol-5-ylmethylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclopropyl-2-(1H-imidazol-5-ylmethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103740239 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | tert-butyl N-[2-cyclopropyl-2-(1H-imidazol-5-ylmethylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(NCc1cnc[nH]1)C1CC1 |
| InChI | InChI=1S/C15H26N4O2/c1-14(2,3)21-13(20)17-9-15(4,11-5-6-11)19-8-12-7-16-10-18-12/h7,10-11,19H,5-6,8-9H2,1-4H3,(H,16,18)(H,17,20) |
| InChIKey | WEGOYOFQISRWMB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |