C16H28N4O2 — CID 124509244
tert-butyl N-[(2S)-2-cyclopropyl-2-[(1-methylpyrazol-4-yl)methylamino]propyl]carbamate (PubChem CID 124509244) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-cyclopropyl-2-[(1-methylpyrazol-4-yl)methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-cyclopropyl-2-[(1-methylpyrazol-4-yl)methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 124509244 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl N-[(2S)-2-cyclopropyl-2-[(1-methylpyrazol-4-yl)methylamino]propyl]carbamate |
| SMILES | Cn1cc(CN[C@](C)(CNC(=O)OC(C)(C)C)C2CC2)cn1 |
| InChI | InChI=1S/C16H28N4O2/c1-15(2,3)22-14(21)17-11-16(4,13-6-7-13)18-8-12-9-19-20(5)10-12/h9-10,13,18H,6-8,11H2,1-5H3,(H,17,21)/t16-/m1/s1 |
| InChIKey | SRZMGVFQVYQFNJ-MRXNPFEDSA-N |
| XLogP | 2.20 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |