C12H21N3O3 — CID 71967740
tert-butyl N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamate (PubChem CID 71967740) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamate |
|---|---|
| PubChem CID | 71967740 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | tert-butyl N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamate |
| SMILES | Cn1cc(C(C)(O)CNC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C12H21N3O3/c1-11(2,3)18-10(16)13-8-12(4,17)9-6-14-15(5)7-9/h6-7,17H,8H2,1-5H3,(H,13,16) |
| InChIKey | FGQDNQAVTOXVLT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |