C14H19BrN2O4 — CID 162755844
tert-butyl N-[3-(4-bromo-2-hydroxyanilino)-3-oxopropyl]carbamate (PubChem CID 162755844) has the molecular formula C14H19BrN2O4 and a molecular weight of 359.22 g/mol. Its IUPAC name is tert-butyl N-[3-(4-bromo-2-hydroxyanilino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-bromo-2-hydroxyanilino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 162755844 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | tert-butyl N-[3-(4-bromo-2-hydroxyanilino)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)Nc1ccc(Br)cc1O |
| InChI | InChI=1S/C14H19BrN2O4/c1-14(2,3)21-13(20)16-7-6-12(19)17-10-5-4-9(15)8-11(10)18/h4-5,8,18H,6-7H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | UZIXKRNZNCFMIO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|