C17H27BrN2O3 — CID 162755732
tert-butyl N-[3-(5-bromo-2-hydroxyanilino)but-3-enyl]carbamate;ethane (PubChem CID 162755732) has the molecular formula C17H27BrN2O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is tert-butyl N-[3-(5-bromo-2-hydroxyanilino)but-3-enyl]carbamate;ethane.
| Compound Name | tert-butyl N-[3-(5-bromo-2-hydroxyanilino)but-3-enyl]carbamate;ethane |
|---|---|
| PubChem CID | 162755732 |
| Molecular Formula | C17H27BrN2O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | tert-butyl N-[3-(5-bromo-2-hydroxyanilino)but-3-enyl]carbamate;ethane |
| SMILES | C=C(CCNC(=O)OC(C)(C)C)Nc1cc(Br)ccc1O.CC |
| InChI | InChI=1S/C15H21BrN2O3.C2H6/c1-10(7-8-17-14(20)21-15(2,3)4)18-12-9-11(16)5-6-13(12)19;1-2/h5-6,9,18-19H,1,7-8H2,2-4H3,(H,17,20);1-2H3 |
| InChIKey | IZKKTICMWLKBSR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|