C15H21BrF2N2O3 — CID 107738048
tert-butyl N-[3-[(5-bromo-2-hydroxyphenyl)methylamino]-2,2-difluoropropyl]carbamate (PubChem CID 107738048) has the molecular formula C15H21BrF2N2O3 and a molecular weight of 395.24 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-bromo-2-hydroxyphenyl)methylamino]-2,2-difluoropropyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-bromo-2-hydroxyphenyl)methylamino]-2,2-difluoropropyl]carbamate |
|---|---|
| PubChem CID | 107738048 |
| Molecular Formula | C15H21BrF2N2O3 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | tert-butyl N-[3-[(5-bromo-2-hydroxyphenyl)methylamino]-2,2-difluoropropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(F)(F)CNCc1cc(Br)ccc1O |
| InChI | InChI=1S/C15H21BrF2N2O3/c1-14(2,3)23-13(22)20-9-15(17,18)8-19-7-10-6-11(16)4-5-12(10)21/h4-6,19,21H,7-9H2,1-3H3,(H,20,22) |
| InChIKey | DJGIZAGCJOKOCJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|