C16H25ClN2O3 — CID 103740291
tert-butyl N-[1-[(5-chloro-2-hydroxyphenyl)methylamino]-2-methylpropan-2-yl]carbamate (PubChem CID 103740291) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is tert-butyl N-[1-[(5-chloro-2-hydroxyphenyl)methylamino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(5-chloro-2-hydroxyphenyl)methylamino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 103740291 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | tert-butyl N-[1-[(5-chloro-2-hydroxyphenyl)methylamino]-2-methylpropan-2-yl]carbamate |
| SMILES | CC(C)(CNCc1cc(Cl)ccc1O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25ClN2O3/c1-15(2,3)22-14(21)19-16(4,5)10-18-9-11-8-12(17)6-7-13(11)20/h6-8,18,20H,9-10H2,1-5H3,(H,19,21) |
| InChIKey | WKKXRCYLXOASFD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|