C16H24ClFN2O2 — CID 103844995
tert-butyl N-[2-[(5-chloro-2-fluorophenyl)methylamino]-2-methylpropyl]carbamate (PubChem CID 103844995) has the molecular formula C16H24ClFN2O2 and a molecular weight of 330.83 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-chloro-2-fluorophenyl)methylamino]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-chloro-2-fluorophenyl)methylamino]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 103844995 |
| Molecular Formula | C16H24ClFN2O2 |
| Molecular Weight | 330.83 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | tert-butyl N-[2-[(5-chloro-2-fluorophenyl)methylamino]-2-methylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC(C)(C)C)NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H24ClFN2O2/c1-15(2,3)22-14(21)19-10-16(4,5)20-9-11-8-12(17)6-7-13(11)18/h6-8,20H,9-10H2,1-5H3,(H,19,21) |
| InChIKey | XDFMCGPICCYQTB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |