C16H26N2O4 — CID 107249254
tert-butyl N-[2-[(2,3-dihydroxyphenyl)methylamino]-2-methylpropyl]carbamate (PubChem CID 107249254) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,3-dihydroxyphenyl)methylamino]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,3-dihydroxyphenyl)methylamino]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 107249254 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl N-[2-[(2,3-dihydroxyphenyl)methylamino]-2-methylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC(C)(C)C)NCc1cccc(O)c1O |
| InChI | InChI=1S/C16H26N2O4/c1-15(2,3)22-14(21)17-10-16(4,5)18-9-11-7-6-8-12(19)13(11)20/h6-8,18-20H,9-10H2,1-5H3,(H,17,21) |
| InChIKey | NXSIHYLHXHAQQH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|