C16H25BrN2O3 — CID 107249155
tert-butyl N-[2-[(3-bromo-4-hydroxyphenyl)methylamino]-2-methylpropyl]carbamate (PubChem CID 107249155) has the molecular formula C16H25BrN2O3 and a molecular weight of 373.29 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-bromo-4-hydroxyphenyl)methylamino]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-bromo-4-hydroxyphenyl)methylamino]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 107249155 |
| Molecular Formula | C16H25BrN2O3 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | tert-butyl N-[2-[(3-bromo-4-hydroxyphenyl)methylamino]-2-methylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC(C)(C)C)NCc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C16H25BrN2O3/c1-15(2,3)22-14(21)18-10-16(4,5)19-9-11-6-7-13(20)12(17)8-11/h6-8,19-20H,9-10H2,1-5H3,(H,18,21) |
| InChIKey | UZLGFSZRUOIPRY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |