C17H26N2O3 — CID 112997331
tert-butyl N-[2-(2,6-diethylanilino)-2-oxoethyl]carbamate (PubChem CID 112997331) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[2-(2,6-diethylanilino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,6-diethylanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 112997331 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl N-[2-(2,6-diethylanilino)-2-oxoethyl]carbamate |
| SMILES | CCc1cccc(CC)c1NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-6-12-9-8-10-13(7-2)15(12)19-14(20)11-18-16(21)22-17(3,4)5/h8-10H,6-7,11H2,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | UFROQRXKDFERAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |