C18H28N2O3S — CID 84553630
tert-butyl N-[2-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84553630) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84553630 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl N-[2-[2-(2-ethyl-6-methylanilino)-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | CCc1cccc(C)c1NC(=O)CSCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O3S/c1-6-14-9-7-8-13(2)16(14)20-15(21)12-24-11-10-19-17(22)23-18(3,4)5/h7-9H,6,10-12H2,1-5H3,(H,19,22)(H,20,21) |
| InChIKey | RPTOJTUNZIAYPD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|