C23H28N2O5 — CID 8520885
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (PubChem CID 8520885) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 8520885 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-6-16-10-7-9-15(2)20(16)25-19(26)14-29-21(27)17-11-8-12-18(13-17)24-22(28)30-23(3,4)5/h7-13H,6,14H2,1-5H3,(H,24,28)(H,25,26) |
| InChIKey | VELLASQQLXDBPL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |