C19H21N3O4 — CID 8803868
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(carbamoylamino)benzoate (PubChem CID 8803868) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(carbamoylamino)benzoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 8803868 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(carbamoylamino)benzoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)c1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-3-13-7-4-6-12(2)17(13)22-16(23)11-26-18(24)14-8-5-9-15(10-14)21-19(20)25/h4-10H,3,11H2,1-2H3,(H,22,23)(H3,20,21,25) |
| InChIKey | BFYBFLIDKWYBBI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |