C16H21F3N2O3S — CID 84553746
tert-butyl N-[2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylethyl]carbamate (PubChem CID 84553746) has the molecular formula C16H21F3N2O3S and a molecular weight of 378.42 g/mol. Its IUPAC name is tert-butyl N-[2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84553746 |
| Molecular Formula | C16H21F3N2O3S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | tert-butyl N-[2-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N2O3S/c1-15(2,3)24-14(23)20-8-9-25-10-13(22)21-12-6-4-11(5-7-12)16(17,18)19/h4-7H,8-10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | YZQSBAILIZYTIQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|