C19H20F3N3O3 — CID 171782912
tert-butyl N-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]carbamate (PubChem CID 171782912) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 171782912 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl N-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(NC(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-18(2,3)28-17(27)25-15-6-4-5-14(11-15)24-16(26)23-13-9-7-12(8-10-13)19(20,21)22/h4-11H,1-3H3,(H,25,27)(H2,23,24,26) |
| InChIKey | UUEGCSHBNWXKTP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |