C26H21F3N2O4 — CID 69416448
2-methyl-2-[4-[2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]ethynyl]phenoxy]propanoic acid (PubChem CID 69416448) has the molecular formula C26H21F3N2O4 and a molecular weight of 482.46 g/mol. Its IUPAC name is 2-methyl-2-[4-[2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]ethynyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]ethynyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 69416448 |
| Molecular Formula | C26H21F3N2O4 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-methyl-2-[4-[2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]ethynyl]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1ccc(C#Cc2cccc(NC(=O)Nc3ccc(C(F)(F)F)cc3)c2)cc1)C(=O)O |
| InChI | InChI=1S/C26H21F3N2O4/c1-25(2,23(32)33)35-22-14-8-17(9-15-22)6-7-18-4-3-5-21(16-18)31-24(34)30-20-12-10-19(11-13-20)26(27,28)29/h3-5,8-16H,1-2H3,(H,32,33)(H2,30,31,34) |
| InChIKey | JRBBURNHINNOJE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|