C26H25F3N2O3S — CID 89312875
2-methyl-2-[4-[2-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]ethyl]phenoxy]propanoic acid (PubChem CID 89312875) has the molecular formula C26H25F3N2O3S and a molecular weight of 502.56 g/mol. Its IUPAC name is 2-methyl-2-[4-[2-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]ethyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[2-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]ethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 89312875 |
| Molecular Formula | C26H25F3N2O3S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-methyl-2-[4-[2-[4-[[3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]ethyl]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1ccc(CCc2ccc(NC(=S)Nc3cccc(C(F)(F)F)c3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H25F3N2O3S/c1-25(2,23(32)33)34-22-14-10-18(11-15-22)7-6-17-8-12-20(13-9-17)30-24(35)31-21-5-3-4-19(16-21)26(27,28)29/h3-5,8-16H,6-7H2,1-2H3,(H,32,33)(H2,30,31,35) |
| InChIKey | XWFLEKCYBUQCHA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|