C17H16F3N3OS — CID 17371957
1-(3-phenylpropanoylamino)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 17371957) has the molecular formula C17H16F3N3OS and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-(3-phenylpropanoylamino)-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(3-phenylpropanoylamino)-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17371957 |
| Molecular Formula | C17H16F3N3OS |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-(3-phenylpropanoylamino)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=C(CCc1ccccc1)NNC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N3OS/c18-17(19,20)13-7-4-8-14(11-13)21-16(25)23-22-15(24)10-9-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,22,24)(H2,21,23,25) |
| InChIKey | DWLWAGODTHQHRL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|