C21H23F3N4O2S — CID 43948662
4-tert-butyl-N-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]benzamide (PubChem CID 43948662) has the molecular formula C21H23F3N4O2S and a molecular weight of 452.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 43948662 |
| Molecular Formula | C21H23F3N4O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 4-tert-butyl-N-[2-oxo-2-[2-[[3-(trifluoromethyl)phenyl]carbamothioyl]hydrazinyl]ethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)NNC(=S)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H23F3N4O2S/c1-20(2,3)14-9-7-13(8-10-14)18(30)25-12-17(29)27-28-19(31)26-16-6-4-5-15(11-16)21(22,23)24/h4-11H,12H2,1-3H3,(H,25,30)(H,27,29)(H2,26,28,31) |
| InChIKey | CTJZPTJVSPRYCM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|