C17H15F3N2OS — CID 17099913
4-ethyl-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 17099913) has the molecular formula C17H15F3N2OS and a molecular weight of 352.38 g/mol. Its IUPAC name is 4-ethyl-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-ethyl-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17099913 |
| Molecular Formula | C17H15F3N2OS |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-ethyl-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H15F3N2OS/c1-2-11-6-8-12(9-7-11)15(23)22-16(24)21-14-5-3-4-13(10-14)17(18,19)20/h3-10H,2H2,1H3,(H2,21,22,23,24) |
| InChIKey | WTNZGQUTVXCHFY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|