C15H10F4N2OS — CID 1231329
4-fluoro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 1231329) has the molecular formula C15H10F4N2OS and a molecular weight of 342.32 g/mol. Its IUPAC name is 4-fluoro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-fluoro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1231329 |
| Molecular Formula | C15H10F4N2OS |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 4-fluoro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10F4N2OS/c16-11-6-4-9(5-7-11)13(22)21-14(23)20-12-3-1-2-10(8-12)15(17,18)19/h1-8H,(H2,20,21,22,23) |
| InChIKey | QDNQANIYTVAQPZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|