C15H9Cl2F3N2OS — CID 139070486
2,6-dichloro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 139070486) has the molecular formula C15H9Cl2F3N2OS and a molecular weight of 393.22 g/mol. Its IUPAC name is 2,6-dichloro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,6-dichloro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 139070486 |
| Molecular Formula | C15H9Cl2F3N2OS |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 2,6-dichloro-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(C(F)(F)F)c1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H9Cl2F3N2OS/c16-10-5-2-6-11(17)12(10)13(23)22-14(24)21-9-4-1-3-8(7-9)15(18,19)20/h1-7H,(H2,21,22,23,24) |
| InChIKey | JYDDMKXDZDJAOC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|