C15H9ClF3IN2OS — CID 2205811
2-chloro-5-iodo-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 2205811) has the molecular formula C15H9ClF3IN2OS and a molecular weight of 484.67 g/mol. Its IUPAC name is 2-chloro-5-iodo-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-chloro-5-iodo-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2205811 |
| Molecular Formula | C15H9ClF3IN2OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 483.91 |
| IUPAC Name | 2-chloro-5-iodo-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(C(F)(F)F)c1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C15H9ClF3IN2OS/c16-12-5-4-9(20)7-11(12)13(23)22-14(24)21-10-3-1-2-8(6-10)15(17,18)19/h1-7H,(H2,21,22,23,24) |
| InChIKey | LTVWNBDMCXIOKQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|