C13H8ClI2N3OS — CID 4504034
2-chloro-5-iodo-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide (PubChem CID 4504034) has the molecular formula C13H8ClI2N3OS and a molecular weight of 543.56 g/mol. Its IUPAC name is 2-chloro-5-iodo-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide.
| Compound Name | 2-chloro-5-iodo-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4504034 |
| Molecular Formula | C13H8ClI2N3OS |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 542.82 |
| IUPAC Name | 2-chloro-5-iodo-N-[(5-iodo-2-pyridinyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(I)cn1)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C13H8ClI2N3OS/c14-10-3-1-7(15)5-9(10)12(20)19-13(21)18-11-4-2-8(16)6-17-11/h1-6H,(H2,17,18,19,20,21) |
| InChIKey | YVBHGZGADMKUSV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|