C12H7Cl2IN2O — CID 23440185
2,6-dichloro-N-(5-iodo-2-pyridinyl)benzamide (PubChem CID 23440185) has the molecular formula C12H7Cl2IN2O and a molecular weight of 393.01 g/mol. Its IUPAC name is 2,6-dichloro-N-(5-iodo-2-pyridinyl)benzamide.
| Compound Name | 2,6-dichloro-N-(5-iodo-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 23440185 |
| Molecular Formula | C12H7Cl2IN2O |
| Molecular Weight | 393.01 g/mol |
| Exact Mass | 391.90 |
| IUPAC Name | 2,6-dichloro-N-(5-iodo-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccc(I)cn1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H7Cl2IN2O/c13-8-2-1-3-9(14)11(8)12(18)17-10-5-4-7(15)6-16-10/h1-6H,(H,16,17,18) |
| InChIKey | PYYYERHOXLUHNW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.01 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|