C12H8Cl3N3O — CID 134102994
2,6-dichloro-N'-(5-chloro-2-pyridinyl)benzohydrazide (PubChem CID 134102994) has the molecular formula C12H8Cl3N3O and a molecular weight of 316.58 g/mol. Its IUPAC name is 2,6-dichloro-N'-(5-chloro-2-pyridinyl)benzohydrazide.
| Compound Name | 2,6-dichloro-N'-(5-chloro-2-pyridinyl)benzohydrazide |
|---|---|
| PubChem CID | 134102994 |
| Molecular Formula | C12H8Cl3N3O |
| Molecular Weight | 316.58 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 2,6-dichloro-N'-(5-chloro-2-pyridinyl)benzohydrazide |
| SMILES | O=C(NNc1ccc(Cl)cn1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H8Cl3N3O/c13-7-4-5-10(16-6-7)17-18-12(19)11-8(14)2-1-3-9(11)15/h1-6H,(H,16,17)(H,18,19) |
| InChIKey | RFUBNSMEUKTNQC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|