C13H9BrCl2N4O2 — CID 118110158
2-amino-5-bromo-N'-(2,6-dichlorobenzoyl)pyridine-3-carbohydrazide (PubChem CID 118110158) has the molecular formula C13H9BrCl2N4O2 and a molecular weight of 404.05 g/mol. Its IUPAC name is 2-amino-5-bromo-N'-(2,6-dichlorobenzoyl)pyridine-3-carbohydrazide.
| Compound Name | 2-amino-5-bromo-N'-(2,6-dichlorobenzoyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 118110158 |
| Molecular Formula | C13H9BrCl2N4O2 |
| Molecular Weight | 404.05 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | 2-amino-5-bromo-N'-(2,6-dichlorobenzoyl)pyridine-3-carbohydrazide |
| SMILES | Nc1ncc(Br)cc1C(=O)NNC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H9BrCl2N4O2/c14-6-4-7(11(17)18-5-6)12(21)19-20-13(22)10-8(15)2-1-3-9(10)16/h1-5H,(H2,17,18)(H,19,21)(H,20,22) |
| InChIKey | YTWWWUDKKKOPHQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.05 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|