C12H9BrCl2N4O — CID 65498887
5-bromo-N-(2,6-dichlorophenyl)-2-hydrazinylpyridine-3-carboxamide (PubChem CID 65498887) has the molecular formula C12H9BrCl2N4O and a molecular weight of 376.04 g/mol. Its IUPAC name is 5-bromo-N-(2,6-dichlorophenyl)-2-hydrazinylpyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(2,6-dichlorophenyl)-2-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 65498887 |
| Molecular Formula | C12H9BrCl2N4O |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 5-bromo-N-(2,6-dichlorophenyl)-2-hydrazinylpyridine-3-carboxamide |
| SMILES | NNc1ncc(Br)cc1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H9BrCl2N4O/c13-6-4-7(11(19-16)17-5-6)12(20)18-10-8(14)2-1-3-9(10)15/h1-5H,16H2,(H,17,19)(H,18,20) |
| InChIKey | QHZMNIHLLZPTTI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|