C13H10BrCl2N3O — CID 65499656
5-bromo-N-(2,6-dichlorophenyl)-2-(methylamino)pyridine-3-carboxamide (PubChem CID 65499656) has the molecular formula C13H10BrCl2N3O and a molecular weight of 375.05 g/mol. Its IUPAC name is 5-bromo-N-(2,6-dichlorophenyl)-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(2,6-dichlorophenyl)-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 65499656 |
| Molecular Formula | C13H10BrCl2N3O |
| Molecular Weight | 375.05 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | 5-bromo-N-(2,6-dichlorophenyl)-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncc(Br)cc1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H10BrCl2N3O/c1-17-12-8(5-7(14)6-18-12)13(20)19-11-9(15)3-2-4-10(11)16/h2-6H,1H3,(H,17,18)(H,19,20) |
| InChIKey | AADQCQPJJUZRBX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.05 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |