C14H15BrN4O2 — CID 62236794
5-bromo-2-hydrazinyl-N-[4-(2-hydroxyethyl)phenyl]pyridine-3-carboxamide (PubChem CID 62236794) has the molecular formula C14H15BrN4O2 and a molecular weight of 351.20 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-[4-(2-hydroxyethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-[4-(2-hydroxyethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62236794 |
| Molecular Formula | C14H15BrN4O2 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-[4-(2-hydroxyethyl)phenyl]pyridine-3-carboxamide |
| SMILES | NNc1ncc(Br)cc1C(=O)Nc1ccc(CCO)cc1 |
| InChI | InChI=1S/C14H15BrN4O2/c15-10-7-12(13(19-16)17-8-10)14(21)18-11-3-1-9(2-4-11)5-6-20/h1-4,7-8,20H,5-6,16H2,(H,17,19)(H,18,21) |
| InChIKey | CCBDNRJNSQVLBJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|