C13H11Cl2N3O2 — CID 61221964
3,6-dichloro-N-[4-(2-hydroxyethyl)phenyl]pyridazine-4-carboxamide (PubChem CID 61221964) has the molecular formula C13H11Cl2N3O2 and a molecular weight of 312.16 g/mol. Its IUPAC name is 3,6-dichloro-N-[4-(2-hydroxyethyl)phenyl]pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-[4-(2-hydroxyethyl)phenyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 61221964 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3,6-dichloro-N-[4-(2-hydroxyethyl)phenyl]pyridazine-4-carboxamide |
| SMILES | O=C(Nc1ccc(CCO)cc1)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C13H11Cl2N3O2/c14-11-7-10(12(15)18-17-11)13(20)16-9-3-1-8(2-4-9)5-6-19/h1-4,7,19H,5-6H2,(H,16,20) |
| InChIKey | JXOLVHKGHSPRJR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |