C11H5Cl4N3O2 — CID 136812221
3,6-dichloro-N-(3,5-dichloro-4-hydroxyphenyl)pyridazine-4-carboxamide (PubChem CID 136812221) has the molecular formula C11H5Cl4N3O2 and a molecular weight of 352.99 g/mol. Its IUPAC name is 3,6-dichloro-N-(3,5-dichloro-4-hydroxyphenyl)pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-(3,5-dichloro-4-hydroxyphenyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 136812221 |
| Molecular Formula | C11H5Cl4N3O2 |
| Molecular Weight | 352.99 g/mol |
| Exact Mass | 350.91 |
| IUPAC Name | 3,6-dichloro-N-(3,5-dichloro-4-hydroxyphenyl)pyridazine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C11H5Cl4N3O2/c12-6-1-4(2-7(13)9(6)19)16-11(20)5-3-8(14)17-18-10(5)15/h1-3,19H,(H,16,20) |
| InChIKey | HQNZYXZTARNGSA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.99 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|