C11H5BrCl3N3O — CID 114038582
N-(2-bromo-3-chlorophenyl)-3,6-dichloropyridazine-4-carboxamide (PubChem CID 114038582) has the molecular formula C11H5BrCl3N3O and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-3,6-dichloropyridazine-4-carboxamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-3,6-dichloropyridazine-4-carboxamide |
|---|---|
| PubChem CID | 114038582 |
| Molecular Formula | C11H5BrCl3N3O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 378.87 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-3,6-dichloropyridazine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Br)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C11H5BrCl3N3O/c12-9-6(13)2-1-3-7(9)16-11(19)5-4-8(14)17-18-10(5)15/h1-4H,(H,16,19) |
| InChIKey | KYRMBCQROJULLN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |