C11H5Cl4N3O — CID 13456235
3,6-dichloro-N-(2,4-dichlorophenyl)pyridazine-4-carboxamide (PubChem CID 13456235) has the molecular formula C11H5Cl4N3O and a molecular weight of 336.99 g/mol. Its IUPAC name is 3,6-dichloro-N-(2,4-dichlorophenyl)pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-(2,4-dichlorophenyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 13456235 |
| Molecular Formula | C11H5Cl4N3O |
| Molecular Weight | 336.99 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 3,6-dichloro-N-(2,4-dichlorophenyl)pyridazine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C11H5Cl4N3O/c12-5-1-2-8(7(13)3-5)16-11(19)6-4-9(14)17-18-10(6)15/h1-4H,(H,16,19) |
| InChIKey | PARRBRLXALXTJE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.99 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |