C13H8BrClF2N2O — CID 103477239
2-amino-N-(2-bromo-3-chlorophenyl)-4,5-difluorobenzamide (PubChem CID 103477239) has the molecular formula C13H8BrClF2N2O and a molecular weight of 361.57 g/mol. Its IUPAC name is 2-amino-N-(2-bromo-3-chlorophenyl)-4,5-difluorobenzamide.
| Compound Name | 2-amino-N-(2-bromo-3-chlorophenyl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 103477239 |
| Molecular Formula | C13H8BrClF2N2O |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 2-amino-N-(2-bromo-3-chlorophenyl)-4,5-difluorobenzamide |
| SMILES | Nc1cc(F)c(F)cc1C(=O)Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C13H8BrClF2N2O/c14-12-7(15)2-1-3-11(12)19-13(20)6-4-8(16)9(17)5-10(6)18/h1-5H,18H2,(H,19,20) |
| InChIKey | UESDZFCVNKNJIH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|