C13H6BrClF3NO2 — CID 103479739
N-(2-bromo-3-chlorophenyl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 103479739) has the molecular formula C13H6BrClF3NO2 and a molecular weight of 380.55 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 103479739 |
| Molecular Formula | C13H6BrClF3NO2 |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | O=C(Nc1cccc(Cl)c1Br)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H6BrClF3NO2/c14-9-6(15)2-1-3-8(9)19-13(21)5-4-7(16)11(18)12(20)10(5)17/h1-4,20H,(H,19,21) |
| InChIKey | NPAWBYWBFIAFMA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|