C13H9BrClNO3 — CID 107688834
N-(2-bromo-3-chlorophenyl)-2,6-dihydroxybenzamide (PubChem CID 107688834) has the molecular formula C13H9BrClNO3 and a molecular weight of 342.58 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-2,6-dihydroxybenzamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107688834 |
| Molecular Formula | C13H9BrClNO3 |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-2,6-dihydroxybenzamide |
| SMILES | O=C(Nc1cccc(Cl)c1Br)c1c(O)cccc1O |
| InChI | InChI=1S/C13H9BrClNO3/c14-12-7(15)3-1-4-8(12)16-13(19)11-9(17)5-2-6-10(11)18/h1-6,17-18H,(H,16,19) |
| InChIKey | RECXBUDEHZBNRU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |