C13H7ClF3NO3 — CID 64788897
N-(2-chloro-4-hydroxyphenyl)-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 64788897) has the molecular formula C13H7ClF3NO3 and a molecular weight of 317.65 g/mol. Its IUPAC name is N-(2-chloro-4-hydroxyphenyl)-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-(2-chloro-4-hydroxyphenyl)-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 64788897 |
| Molecular Formula | C13H7ClF3NO3 |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | N-(2-chloro-4-hydroxyphenyl)-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(O)cc1Cl)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C13H7ClF3NO3/c14-7-3-5(19)1-2-9(7)18-13(21)6-4-8(15)11(17)12(20)10(6)16/h1-4,19-20H,(H,18,21) |
| InChIKey | LMODEDYYAKZPBH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|