C13H8Cl3NO2 — CID 64787158
2,3-dichloro-N-(2-chloro-4-hydroxyphenyl)benzamide (PubChem CID 64787158) has the molecular formula C13H8Cl3NO2 and a molecular weight of 316.57 g/mol. Its IUPAC name is 2,3-dichloro-N-(2-chloro-4-hydroxyphenyl)benzamide.
| Compound Name | 2,3-dichloro-N-(2-chloro-4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 64787158 |
| Molecular Formula | C13H8Cl3NO2 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2,3-dichloro-N-(2-chloro-4-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1ccc(O)cc1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl3NO2/c14-9-3-1-2-8(12(9)16)13(19)17-11-5-4-7(18)6-10(11)15/h1-6,18H,(H,17,19) |
| InChIKey | BUWSYGWZBYICOZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|