C13H7BrCl3NO — CID 81028936
N-(2-bromo-4-chlorophenyl)-2,3-dichlorobenzamide (PubChem CID 81028936) has the molecular formula C13H7BrCl3NO and a molecular weight of 379.47 g/mol. Its IUPAC name is N-(2-bromo-4-chlorophenyl)-2,3-dichlorobenzamide.
| Compound Name | N-(2-bromo-4-chlorophenyl)-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 81028936 |
| Molecular Formula | C13H7BrCl3NO |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 376.88 |
| IUPAC Name | N-(2-bromo-4-chlorophenyl)-2,3-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Br)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H7BrCl3NO/c14-9-6-7(15)4-5-11(9)18-13(19)8-2-1-3-10(16)12(8)17/h1-6H,(H,18,19) |
| InChIKey | OVIYPOLVDZQRFY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |