C14H9BrClF2NO — CID 103480092
N-(2-bromo-3-chlorophenyl)-2,4-difluoro-5-methylbenzamide (PubChem CID 103480092) has the molecular formula C14H9BrClF2NO and a molecular weight of 360.59 g/mol. Its IUPAC name is N-(2-bromo-3-chlorophenyl)-2,4-difluoro-5-methylbenzamide.
| Compound Name | N-(2-bromo-3-chlorophenyl)-2,4-difluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 103480092 |
| Molecular Formula | C14H9BrClF2NO |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | N-(2-bromo-3-chlorophenyl)-2,4-difluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(Cl)c2Br)c(F)cc1F |
| InChI | InChI=1S/C14H9BrClF2NO/c1-7-5-8(11(18)6-10(7)17)14(20)19-12-4-2-3-9(16)13(12)15/h2-6H,1H3,(H,19,20) |
| InChIKey | GORMJMAQTSOOAU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |